6-Bromo-DL-tryptophan is a halogenated derivative of the amino acid tryptophan, identified as a research reagent. It features a bromine atom at the 6-position of the indole ring, contributing to its structural character as an aromatic, polar compound.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
6-BROMO-DL-TRYPTOPHAN 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Heptafluorobutyric anhydride
derivatising reagent for gas chromatography
4-methoxy-1-N-methylbenzene-1,2-diamine
research compound
3-AMINO-4-METHOXYPYRIDINE
Research compound
1-methyl-1H-pyrazol-5-ol
research compound
(R)-2-Amino-3-(6-bromo-1H-indol-3-yl)propanoic acid
Peptide building block for research
6-BROMO-L-TRYPTOPHAN
research compound
2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid
OAORYCZPERQARS-UHFFFAOYSA-N
C1=CC2=C(C=C1Br)NC=C2CC(C(=O)O)N
6-BROMO-DL-TRYPTOPHAN 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.