Dideoxy GTP is a dideoxynucleotide triphosphate used as a chain-terminating inhibitor in the Sanger method of DNA sequencing. It lacks hydroxyl groups at the 2' and 3' positions of the ribose sugar, preventing further DNA strand elongation by DNA polymerase.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 68726-28-3
3'-amino-2',3'-dideoxyguanosine 5'-(tetrahydrogen triphosphate)
Nucleotide analogue research reagent
DdATP
DNA sequencing reagent
Boc-2-aminobenzoic acid
research compound
5-Bromo-4,6-dichloropyrimidine
Research chemical intermediate
Ethylenediaminetriacetic acid
chelating agent
4-Methoxy-3-methylbenzoic Acid
research compound
[[(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
HDRRAMINWIWTNU-PRJDIBJQSA-N
C1CC(O[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O