3'-amino-2',3'-dideoxyguanosine 5'-(tetrahydrogen triphosphate) is a modified nucleotide analogue used in biochemical research. Its structure features a guanine base attached to a deoxyribose sugar with an amino group at the 3' position and a triphosphate chain, making it a valuable tool for studying nucleic acid synthesis and enzyme mechanisms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Guanosine 5'-(tetrahydrogen triphosphate), 2'-deoxy-, trisodium salt
nucleotide triphosphate intermediate
DGTP
research compound
Dideoxy GTP
DNA sequencing reagent
JI-101
research compound
(S)-Methyl 2-((S)-2-amino-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
1-Phenyl-d5-ethanol
deuterated research standard
(2-ethylhexyl)magnesium bromide
Grignard reagent for organic synthesis
[[(2S,3S,5R)-3-amino-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
ILTYANYMUGEMNF-KVQBGUIXSA-N
C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.