1-Phenyl-d5-ethanol is a deuterated research standard where the hydrogen atoms on the phenyl ring are replaced with deuterium. It is commonly used as an internal standard or labeled compound in analytical chemistry and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1-Phenyl-d5-ethanol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2-ethylhexyl)magnesium bromide
Grignard reagent for organic synthesis
Nitrilase
research compound
Tannase
enzyme for biochemical research
3-fluoro-4-methylbenzene-1-sulfonyl chloride
research compound
1-Phenylethanol
Flavoring and perfumery agent
1-Phenylethanol
Flavoring agent and perfumery ingredient
(S)-1-Phenylethanol
flavor and fragrance ingredient
(R)-1-phenylethanol
Fragrance ingredient
1-Phenyl-d5-ethanol(CAS 90162-45-1)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1-(2,3,4,5,6-pentadeuteriophenyl)ethanol
WAPNOHKVXSQRPX-VIQYUKPQSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C(C)O)[2H])[2H]
1-Phenyl-d5-ethanol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.