Dimethyl N-(tert-butoxycarbonyl)-L-glutamate is a Boc-protected amino acid derivative used as an intermediate in pharmaceutical manufacturing. It features a tert-butoxycarbonyl protecting group on the amino functionality and two ester groups, contributing to its role as a building block in peptide synthesis and drug development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dimethyl N-(tert-butoxycarbonyl)-L-glutamate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(S)-1-tert-Butyl 5-methyl 2-((tert-butoxycarbonyl)amino)pentanedioate
research compound
(4S)-4-{[(tert-butoxy)carbonyl]amino}-5-methoxy-5-oxopentanoic acid
pharmaceutical intermediate for peptide synthesis
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid
Protected amino acid for peptide synthesis
Ethyl N-(2-((tert-butoxycarbonyl)amino)ethyl)glycinate--hydrogen chloride (1/1)
Boc-protected amino acid intermediate
1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2S)-
Boc-protected amino acid intermediate
(2S,3R)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
Boc-protected amino acid intermediate
Methyl 3-[(tert-butoxycarbonyl)amino]-L-alaninate
Boc-protected amino acid intermediate
Chloro(iodo)methane
Pharmaceutical intermediate
dimethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate
QNSPKWUAZQIIGZ-QMMMGPOBSA-N
CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC)C(=O)OC
Dimethyl N-(tert-butoxycarbonyl)-L-glutamate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.