This compound is a Boc-protected derivative of L-pyroglutamic acid, commonly used as an intermediate in peptide synthesis. Its structure features a tert-butoxycarbonyl (Boc) protecting group and a stereocenter, making it suitable for building chiral peptide chains.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Di-tert-butyl (2s)-5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
(R)-Di-tert-butyl 5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
1-O-tert-butyl 2-O-methyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
1-tert-butyl 2-methyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
Dimethyl N-(tert-butoxycarbonyl)-L-glutamate
Boc-protected amino acid intermediate
1-tert-butyl 2-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate
Boc-protected amino acid intermediate
Ethyl N-(2-((tert-butoxycarbonyl)amino)ethyl)glycinate--hydrogen chloride (1/1)
Boc-protected amino acid intermediate
3-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid
Boc-protected amino acid intermediate
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopyrrolidine-2-carboxylic acid
MJLQPFJGZTYCMH-LURJTMIESA-N
CC(C)(C)OC(=O)N1[C@@H](CCC1=O)C(=O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.