N-tert-butoxycarbonyl-L-pyroglutamic acid methyl ester is a protected amino acid derivative commonly employed as a pharmaceutical intermediate. Its primary significance lies in its use for peptide synthesis, where the tert-butoxycarbonyl (Boc) group serves as a temporary protecting group for the amine functionality.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(R)-Di-tert-butyl 5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
Di-tert-butyl (2s)-5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2S)-
Boc-protected amino acid intermediate
1-(1,1-Dimethylethyl) 2-ethyl (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Pharmaceutical intermediate for peptide synthesis
3-HYDROXYPYRIDINE
pharmaceutical intermediate
1-Methylpiperazine
Pharmaceutical intermediate and fine chemical
4-Methylmorpholine
pharmaceutical intermediate
2-BROMOPYRIDINE
Intermediate for pharmaceuticals and agrochemicals
1-O-tert-butyl 2-O-methyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate(CAS 108963-96-8)의 국제 HS 코드는 2933.79입니다.
2933.79
2933 79 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1-O-tert-butyl 2-O-methyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate
FNTAOUUEQHKLIU-ZETCQYMHSA-N
CC(C)(C)OC(=O)N1[C@@H](CCC1=O)C(=O)OC
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.