This compound is a protected amino acid derivative used as an intermediate in peptide synthesis. Its structure features a tert-butyloxycarbonyl (Boc) protecting group on the amine and a methyl ester on the side chain carboxyl, making it suitable for selective peptide chain assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 45214-91-3
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
Dimethyl N-(tert-butoxycarbonyl)-L-glutamate
Boc-protected amino acid intermediate
(S)-1-tert-Butyl 5-methyl 2-((tert-butoxycarbonyl)amino)pentanedioate
research compound
Boc-L-glutamine
protected amino acid for peptide synthesis
(5R)-5-(2,2-Dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one
pharmaceutical intermediate
4-Fluoro-3-nitrobenzoic acid
pharmaceutical intermediate
Boc-glycine
amino acid protecting reagent
[3,3'-Bifuran]-2,2',5,5'-tetrone, tetrahydro-
Pharmaceutical intermediate
(2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid
OHYMUFVCRVPMEY-ZETCQYMHSA-N
CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC)C(=O)O