Boc-L-glutamine is a protected amino acid derivative commonly used as a building block in peptide synthesis. The compound features a tert-butoxycarbonyl (Boc) protecting group attached to the alpha-amino group, which allows for selective deprotection during solid-phase or solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13726-85-7
(2S)-2-{[(tert-butoxy)carbonyl]amino}pentanedioic acid
Peptide synthesis intermediate
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid
Protected amino acid for peptide synthesis
Boc-lysine
protected amino acid for peptide synthesis
Boc-Asp(OtBu)-OH
protected amino acid for peptide synthesis
O-Benzyl-N-tert-butoxycarbonyl-L-threonine
protected amino acid for peptide synthesis
BOC-ALA
protected amino acid for peptide synthesis
Pemetrexed acid
pharmaceutical intermediate
(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid
VVNYDCGZZSTUBC-LURJTMIESA-N
CC(C)(C)OC(=O)N[C@@H](CCC(=O)N)C(=O)O