This compound is a Boc-protected amino acid intermediate, specifically the methyl ester of 3-(tert-butoxycarbonylamino)-L-alanine. It is primarily used in pharmaceutical research and manufacturing as a building block for peptide synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Methyl 3-[(tert-butoxycarbonyl)amino]-L-alaninate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(3S)-2-[(Tert-Butoxy)Carbonyl]-1,2,3,4-Tetrahydroisoquinoline-3-Carboxylic Acid
Boc-protected amino acid intermediate
N-boc-2-(indole-3-yl)-dl-glycine
Boc-protected amino acid intermediate
(2S,3R)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
Boc-protected amino acid intermediate
(2S)-2-{[(tert-butoxy)carbonyl]amino}pent-4-enoic acid
Boc-protected amino acid intermediate
4-(chloromethyl)-1,3-thiazole Hydrochloride
Pharmaceutical raw material intermediate
1-benzofuran-6-carboxylic acid
pharmaceutical intermediate
1,2,3-Trifluoro-4-nitrobenzene
pharmaceutical intermediate
2-({[(9H-FLUOREN-9-YL)METHOXY]CARBONYL}(METHYL)AMINO)ACETIC ACID
Peptide synthesis building block
methyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
AXLHVTKGDPVANO-LURJTMIESA-N
CC(C)(C)OC(=O)NC[C@@H](C(=O)OC)N
Methyl 3-[(tert-butoxycarbonyl)amino]-L-alaninate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.