This compound is a Boc-protected amino acid intermediate, specifically a derivative of glycine with an allyl side chain. It is primarily used in pharmaceutical manufacturing and peptide synthesis as a building block.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 90600-20-7
(r)-2-((tert-butoxycarbonyl)amino)-2-(naphthalen-2-yl)acetic acid
Boc-protected amino acid intermediate
(1R,4R)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-cyclopentene-1-carboxylic acid
Boc-protected amino acid intermediate
2-[(1s,4s)-4-{[(tert-butoxy)carbonyl]amino}cyclohexyl]acetic acid
Boc-protected amino acid intermediate
Dimethyl N-(tert-butoxycarbonyl)-L-glutamate
Boc-protected amino acid intermediate
1-benzhydrylazetidin-3-ol Hydrochloride
pharmaceutical intermediate
3,4-dihydro-2H-1-benzopyran-4-amine hydrochloride
pharmaceutical intermediate
SODIUM STARCH GLYCOLATE (II)
Pharmaceutical excipient for tablet formulation
Methyl 5-chloro-3-[[(2-methoxy-2-oxoethyl)amino]sulfonyl]-2-thiophenecarboxylate
pharmaceutical intermediate
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid
BUPDPLXLAKNJMI-ZETCQYMHSA-N
CC(C)(C)OC(=O)N[C@@H](CC=C)C(=O)O