This compound is a Boc-protected amino acid derivative featuring a naphthyl-substituted D-glycine backbone. It is primarily used as an intermediate in the synthesis of peptides and other complex organic molecules in pharmaceutical research and manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 93779-36-3
2-[(1s,4s)-4-{[(tert-butoxy)carbonyl]amino}cyclohexyl]acetic acid
Boc-protected amino acid intermediate
(2S)-2-{[(tert-butoxy)carbonyl]amino}pent-4-enoic acid
Boc-protected amino acid intermediate
Dimethyl N-(tert-butoxycarbonyl)-L-glutamate
Boc-protected amino acid intermediate
(2S,3R)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
Boc-protected amino acid intermediate
2,4,6-Trimethylbenzoyl chloride
Pharmaceutical intermediate
2-amino-2-(4-hydroxyphenyl)acetic acid
Pharmaceutical intermediate for antibiotic synthesis
3-Morpholino-1-(2-thienyl)propan-1-one hydrochloride
Pharmaceutical intermediate for cloperastine
Guanosine 5'-(tetrahydrogen triphosphate), 2'-deoxy-, trisodium salt
nucleotide triphosphate intermediate
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-naphthalen-2-ylacetic acid
MQCLXWDVGKUKHB-CQSZACIVSA-N
CC(C)(C)OC(=O)N[C@H](C1=CC2=CC=CC=C2C=C1)C(=O)O
—