This compound is a fluorinated heterocyclic compound used primarily as a research reagent. Its structure features a pyridine ring with a tert-butyl group and a difluorophenyl substituent, contributing to its lipophilic character.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-(tert-Butyl)-2-(2,4-difluorophenyl)pyridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Tetramethylammonium bicarbonate
Research reagent for organic synthesis
Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate
research compound
2-naphthylalanine
research compound for expanded genetic code
Tetrakis(acetonitrile)copper(I) Trifluoromethanesulfonate
organometallic reagent and catalyst precursor
(2,2'-Bipyridyl)bis[2-(4-fluorophenyl)pyridine]iridium(III) hexafluorophosphate
organometallic research compound
Bis [2- (2,4-difluorophenyl) -5-trifluoromethylpyridine] [1,10-phenanthroline] iridium hexafluorophosphate
research compound
TERT-BUTYL 2-(4-(PYRIDIN-2-YL)BENZYL)HYDRAZINECARBOXYLATE
pharmaceutical intermediate
2-(4-tert-butylphenyl)pyridine
research compound
4-tert-butyl-2-(2,4-difluorophenyl)pyridine
WVAZMTOPXXDDOT-UHFFFAOYSA-N
CC(C)(C)C1=CC(=NC=C1)C2=C(C=C(C=C2)F)F
—
4-(tert-Butyl)-2-(2,4-difluorophenyl)pyridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.