This compound is a pharmaceutical intermediate featuring a tert-butyl carbamate protecting group attached to a hydrazine moiety, which is linked to a biphenyl system containing a pyridine ring. It is primarily used as a building block in the synthesis of more complex organic molecules for pharmaceutical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 198904-85-7
1,1-Dimethylethyl 2-[(2S,3S)-3-[[(1,1-dimethylethoxy)carbonyl]amino]-2-hydroxy-4-phenylbutyl]-2-[[4-(2-pyridinyl)phenyl]methyl]hydrazinecarboxylate
Pharmaceutical Intermediate
(2S,3S)-3-Amino-4-phenyl-1-(1-(4-(pyridin-2-yl)benzyl)hydrazinyl)butan-2-ol trihydrochloride
pharmaceutical intermediate for atazanavir synthesis
Methyl pyrrolidine-3-carboxylate hydrochloride
pharmaceutical intermediate
(3R)-piperidin-3-ol hydrochloride
pharmaceutical intermediate
1,1-Dimethylethyl 2-[[4-(2-pyridinyl)phenyl]methylene]hydrazinecarboxylate
pharmaceutical intermediate
6-phenylpyridin-2-amine
research compound
4-(2-Pyridyl)benzoic acid
research compound
2-(4-tert-butylphenyl)pyridine
research compound
tert-butyl N-[(4-pyridin-2-ylphenyl)methylamino]carbamate
GIMJTKJSKPENNG-UHFFFAOYSA-N
CC(C)(C)OC(=O)NNCC1=CC=C(C=C1)C2=CC=CC=N2
—