4-(2-Pyridyl)benzoic acid is a chemical compound used as a research reagent. It contains both aromatic rings and a carboxylic acid functional group, making it useful in laboratory syntheses and impurity studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4385-62-0
4-(4-pyridyl)benzoic acid
research compound
3-(Pyridin-3-yl)benzoic acid
research compound
3-(Pyridin-4-yl)benzoic acid
Research compound for crystallography studies
(S)-4-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5-oxopentanoic acid
research reagent
(2,2'-Bipyridyl)bis[2-(4-fluorophenyl)pyridine]iridium(III) hexafluorophosphate
organometallic research compound
4-pyridin-2-ylbenzaldehyde
Pharmaceutical intermediate
Bis [2- (2,4-difluorophenyl) -5-trifluoromethylpyridine] [1,10-phenanthroline] iridium hexafluorophosphate
research compound
TERT-BUTYL 2-(4-(PYRIDIN-2-YL)BENZYL)HYDRAZINECARBOXYLATE
pharmaceutical intermediate
4-pyridin-2-ylbenzoic acid
AQIPNZHMXANQRC-UHFFFAOYSA-N
C1=CC=NC(=C1)C2=CC=C(C=C2)C(=O)O