3-(Pyridin-4-yl)benzoic acid is a research compound used in crystallography studies. Its structure features both aromatic and heterocyclic rings, making it a subject of structural analysis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 4385-78-8
10,10'-DIBROMO-9,9'-BIANTHRACENE
Research compound for crystallography studies
3,5-Difluorophenol
Research compound for crystallography studies
Ethyl (2Z)-2-chloro-2-[2-(4-methoxyphenyl)hydrazinylidene]acetate
Research compound for crystallography studies
(2-amino-5-ethylthiophen-3-yl)(2-chlorophenyl)methanone
Research compound for crystallography studies
(S)-4-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5-oxopentanoic acid
research reagent
6-(Trifluoromethyl)pyridine-3,4-diamine
research compound
2-Amino-6-methylbenzoic acid
research compound
2-((3,3-dibutyl-7-(methylthio)-1,1-dioxido-5-phenyl-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepin-8-yl)oxy)acetic acid
research compound
3-pyridin-4-ylbenzoic acid
IYGIZNZSONLPSI-UHFFFAOYSA-N
C1=CC(=CC(=C1)C(=O)O)C2=CC=NC=C2