This compound is a research reagent characterized by a benzothiazepine core structure with butyl, phenyl, and acetic acid substituents. Its significance lies in its use as a laboratory chemical for investigational studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 439088-13-8
Elobixibat
ileal bile acid transporter inhibitor
3,3-Dibutyl-8-hydroxy-7-(methylthio)-5-phenyl-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepine 1,1-dioxide
Pharmaceutical intermediate for research
7-Bromo-3,3-dibutyl-8-methoxy-2,3-dihydrobenzo[b][1,4]thiazepin-4(5H)-one
research compound for structural studies
[Rh COD (R)-Binap]BF4
chiral organometallic catalyst
2,3,4,5,6-Pentafluorobenzyl alcohol
fluorinated benzyl alcohol reagent
6,6'-Dimethyl-2,2'-bipyridine
ligand for metal coordination chemistry
2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1lambda6,5-benzothiazepin-8-yl)oxy]acetic acid
HLVCNERLDVNLEF-UHFFFAOYSA-N
CCCCC1(CN(C2=CC(=C(C=C2S(=O)(=O)C1)OCC(=O)O)SC)C3=CC=CC=C3)CCCC
—