6-(Trifluoromethyl)pyridine-3,4-diamine is a chemical compound featuring a pyridine ring substituted with a trifluoromethyl group and two amino groups. It is primarily utilized as a research reagent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 438564-37-5
2-Amino-6-methylbenzoic acid
research compound
2-((3,3-dibutyl-7-(methylthio)-1,1-dioxido-5-phenyl-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepin-8-yl)oxy)acetic acid
research compound
7-Bromo-3,3-dibutyl-8-methoxy-2,3-dihydrobenzo[b][1,4]thiazepin-4(5H)-one
research compound for structural studies
[Rh COD (R)-Binap]BF4
chiral organometallic catalyst
6-(trifluoromethyl)pyridine-3,4-diamine
ZXYMLNXDEYTMJX-UHFFFAOYSA-N
C1=C(C(=CN=C1C(F)(F)F)N)N
—