2-(4-tert-butylphenyl)pyridine is a chemical compound featuring a pyridine ring bonded to a tert-butyl-substituted phenyl group. Its structure includes two aromatic rings and a single hydrogen bond acceptor, contributing to its moderate lipophilicity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-(4-tert-butylphenyl)pyridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Nitroso-2-naphthol-3,6-disulfonic acid disodium salt
Reagent for cobalt and potassium
Tris (dibenzylideneaceton)dipalladum (O) chloroform adduct
organometallic catalyst for coupling reactions
2-Iodo-5-methylbenzoic acid
research reagent
Cholenic acid
research compound
(2,2'-Bipyridyl)bis[2-(4-fluorophenyl)pyridine]iridium(III) hexafluorophosphate
organometallic research compound
4-(tert-Butyl)-2-phenylpyridine
n.a
4-pyridin-2-ylbenzaldehyde
Pharmaceutical intermediate
4-(tert-Butyl)-2-(2,4-difluorophenyl)pyridine
research compound
2-(4-tert-butylphenyl)pyridine
RHXQSMVSBYAGQV-UHFFFAOYSA-N
CC(C)(C)C1=CC=C(C=C1)C2=CC=CC=N2
2-(4-tert-butylphenyl)pyridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.