1-Nitroso-2-naphthol-3,6-disulfonic acid disodium salt is a research reagent commonly used as a colorimetric or complexometric agent for the detection and determination of cobalt and potassium ions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 525-05-3
Tris (dibenzylideneaceton)dipalladum (O) chloroform adduct
organometallic catalyst for coupling reactions
2-Iodo-5-methylbenzoic acid
research reagent
Cholenic acid
research compound
5-Chloro-1-pentanol
Halogenated alcohol research reagent
disodium;3-hydroxy-4-nitrosonaphthalene-2,7-disulfonate
DMKMTGULLYISBH-UHFFFAOYSA-L
C1=CC2=C(C(=C(C=C2C=C1S(=O)(=O)[O-])S(=O)(=O)[O-])O)N=O.[Na+].[Na+]