2-Naphthylalanine is a research compound used in the context of expanded genetic code studies, where it serves as a non-canonical amino acid for incorporation into proteins. Its structure features a naphthyl ring, contributing to aromatic and hydrophobic properties relevant for probing protein structure and function.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-naphthylalanine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Tetrakis(acetonitrile)copper(I) Trifluoromethanesulfonate
organometallic reagent and catalyst precursor
Tert-Butylchlorodiphenylsilane
silyl protecting group reagent
OLVANIL
Vanilloid receptor research compound
5-chloro-3-methylpyridin-2-ol
research compound
D-3-(2-naphthyl)alanine
pharmaceutical intermediate
(2S)-2-amino-3-naphthalen-2-ylpropanoic acid
JPZXHKDZASGCLU-LBPRGKRZSA-N
C1=CC=C2C=C(C=CC2=C1)C[C@@H](C(=O)O)N
2-naphthylalanine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.