Fisetin is a naturally occurring flavonol found in many fruits and vegetables, recognized for its antioxidant properties and studied as a geroprotector and anti-inflammatory agent. It also functions as an inhibitor of DNA topoisomerase and is investigated in research settings for its potential roles in cellular health.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 528-48-3
Cyanidin chloride
assay reagent
2-Bromopropane-1,1,1,3,3,3-d6
Isotopically labeled reference standard
Acetone hydrazone
research compound
Cyclohexanone, 2,6-bis[(4-azidophenyl)methylene]-4-methyl-
research chemical
Quercetin dihydrate
Dietary supplement and food ingredient
Quercetin
dietary supplement ingredient
2-(3,4-Dihydroxyphenyl)-6-ethyl-3-hydroxychromen-4-one
research compound
Hibiscetin 3,7,4'-trimethyl ether
Research compound
2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one
XHEFDIBZLJXQHF-UHFFFAOYSA-N
C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O