Cyanidin chloride is a research reagent and an anthocyanidin compound commonly used as an assay reagent in laboratory studies. It is a salt-like, aromatic, heterocyclic compound with multiple hydroxyl groups, typically investigated for its antioxidant and color-related properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 528-58-5
Cyanidin
plant pigment and antioxidant
Adenosine 5'-monophosphoramidate sodium salt
assay reagent
2-Bromopropane-1,1,1,3,3,3-d6
Isotopically labeled reference standard
Acetone hydrazone
research compound
Cyclohexanone, 2,6-bis[(4-azidophenyl)methylene]-4-methyl-
research chemical
1-Methyl-1-propylpyrrolidinium chloride
Ionic liquid research compound
2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol chloride
COAWNPJQKJEHPG-UHFFFAOYSA-N
C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O)O.[Cl-]