Cyanidin chloride is a research reagent and an anthocyanidin compound commonly used as an assay reagent in laboratory studies. It is a salt-like, aromatic, heterocyclic compound with multiple hydroxyl groups, typically investigated for its antioxidant and color-related properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Cyanidin chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Cyanidin
plant pigment and antioxidant
Adenosine 5'-monophosphoramidate sodium salt
assay reagent
2-Bromopropane-1,1,1,3,3,3-d6
Isotopically labeled reference standard
Acetone hydrazone
research compound
Cyclohexanone, 2,6-bis[(4-azidophenyl)methylene]-4-methyl-
research chemical
1-Methyl-1-propylpyrrolidinium chloride
Ionic liquid research compound
Cyanidin chloride(CAS 528-58-5)의 국제 HS 코드는 2932.99입니다.
2932.99
2932 99 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol chloride
COAWNPJQKJEHPG-UHFFFAOYSA-N
C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O)O.[Cl-]
Cyanidin chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.