H-AEEA-AEEA-AEEA is a highly flexible, water-soluble linker compound with multiple ether groups, two amide bonds, and terminal amine and carboxylic acid groups. It is primarily used as a research reagent in linker chemistry for constructing bioconjugates or functionalized molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2773558-06-6
Semaglutide impurity 50
Semaglutide process impurity or intermediate
2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid
pharmaceutical intermediate
Ethyl 4-(phenylmethoxy)-1H-indole-2-carboxylate
research compound
9-(2-bromophenyl-3,4,5,6-d4)-9H-carbazole-1,2,3,4,5,6,7,8-d8
deuterated research compound
(2-(9H-carbazol-9-yl-d8)phenyl-3,4,5,6-d4)boronic acid
deuterated research compound
9H-3,9'-bicarbazole-1,1',2,2',3',4,4',5,5',6,6',7,7',8,8'-d15
deuterated research compound
2-[2-[2-[[2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid
DLDHTLVGQUKJDC-UHFFFAOYSA-N
C(COCCOCC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)O)N