Semaglutide impurity 50 is a linear, highly flexible polyethylene glycol-based compound containing multiple amide and ether linkages, used as a process impurity or intermediate in the manufacturing of semaglutide.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Semaglutide impurity 50 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid
pharmaceutical intermediate
H-AEEA-AEEA-AEEA
research reagent for linker chemistry
2,2,2-TRIFLUOROETHYL CHLOROFORMATE
Synthetic intermediate in pharmaceutical chemistry
6-METHOXY-2-METHYL-1-TETRALONE
Pharmaceutical synthetic intermediate
Deacetyl acebutolol
pharmaceutical intermediate
Ethyl trans-2-hexenoate
pharmaceutical intermediate
2-[2-[2-[[2-[2-[2-[[2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid
PCVLTPXWKGYYGD-UHFFFAOYSA-N
C(COCCOCC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)O)N
Semaglutide impurity 50 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.