This compound is a pharmaceutical intermediate with a highly flexible polyether backbone, featuring terminal amine and carboxylic acid groups. Its primary significance lies in its use as a building block for the synthesis of more complex pharmaceutical compounds, particularly those requiring a hydrophilic linker.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
H-AEEA-AEEA-AEEA
research reagent for linker chemistry
Semaglutide impurity 50
Semaglutide process impurity or intermediate
(2R)-2-{[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]AMINO}-4-METHYLPENTANOIC ACID
Peptide synthesis building block
1-(2-Bromophenyl)ethan-1-ol
pharmaceutical intermediate
(r)-2-chloro-1-(2,4-dichlorophenyl)ethanol
pharmaceutical intermediate
N-(Pyrazinylcarbonyl)-L-phenylalanine
Pharmaceutical intermediate
2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid
YQZVQKYXWPIKIX-UHFFFAOYSA-N
C(COCCOCC(=O)NCCOCCOCC(=O)O)N
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.