This compound is a perdeuterated boronic acid derivative containing a carbazole moiety, used as a labeled research reagent. Its high degree of deuteration makes it valuable in analytical and mechanistic studies where isotope labeling is required.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2-(9H-carbazol-9-yl-d8)phenyl-3,4,5,6-d4)boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
9H-3,9'-bicarbazole-1,1',2,2',3',4,4',5,5',6,6',7,7',8,8'-d15
deuterated research compound
9,9'-(6-Chloro-1,3,5-triazine-2,4-diyl)bis(9H-carbazole-1,2,3,4,5,6,7,8-d8)
research compound involving deuterated carbazole-triazine
Tert-Butyl diethylphosphonoacetate
Research reagent for chemical synthesis
Uridine-5'-diphosphate disodium salt
nucleotide sugar research reagent
2-(9H-Carbazol-9-yl)phenylboronic Acid (contains varying amounts of Anhydride)
organic electronics intermediate
[2,3,4,5-tetradeuterio-6-(1,2,3,4,5,6,7,8-octadeuteriocarbazol-9-yl)phenyl]boronic acid
MBWDMWMXFNHYLL-AQZSQYOVSA-N
[2H]C1=C(C(=C(C(=C1[2H])B(O)O)N2C3=C(C(=C(C(=C3C4=C(C(=C(C(=C42)[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]
—
(2-(9H-carbazol-9-yl-d8)phenyl-3,4,5,6-d4)boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.