tert-Butyl diethylphosphonoacetate is a research reagent commonly used in organic synthesis. It serves as a phosphonate building block for the construction of various chemical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 27784-76-5
(3-Iodophenyl)methanesulfonyl chloride
Research reagent for chemical synthesis
[4-(2-Methylpropoxy)phenyl]methanamine Hydrochloride
Research reagent for chemical synthesis
2-Hydroxy-4-methylnicotinic acid
Research reagent for chemical synthesis
3-Chloro-4-pyridineboronic acid
Research reagent for chemical synthesis
Uridine-5'-diphosphate disodium salt
nucleotide sugar research reagent
Thymidine 5'-triphosphate sodium salt
Nucleotide triphosphate for molecular biology
5-Hydroxynicotinic acid
Research reagent
L-Glutamic Acid-d5
Deuterated amino acid analytical standard
tert-butyl 2-diethoxyphosphorylacetate
NFEGNISFSSLEGU-UHFFFAOYSA-N
CCOP(=O)(CC(=O)OC(C)(C)C)OCC
—