(3-Iodophenyl)methanesulfonyl chloride is a chemical compound used as a research reagent in organic synthesis. It features an aromatic ring substituted with iodine and a sulfonyl chloride group, making it a building block for further chemical modifications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(3-Iodophenyl)methanesulfonyl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
[4-(2-Methylpropoxy)phenyl]methanamine Hydrochloride
Research reagent for chemical synthesis
2-Hydroxy-4-methylnicotinic acid
Research reagent for chemical synthesis
3-Chloro-4-pyridineboronic acid
Research reagent for chemical synthesis
7-bromo-1H-indazole
Research reagent for chemical synthesis
4-fluoro-1H-pyrazole
research compound
Beta-Guanidinopropionic acid
creatine analogue for research
CYCLO(-ASP-ASP)
research compound
(R)-(-)-2-Amino-1-propanol
Research compound and synthetic intermediate
(3-iodophenyl)methanesulfonyl chloride
FWYCOHVQIFJXEL-UHFFFAOYSA-N
C1=CC(=CC(=C1)I)CS(=O)(=O)Cl
(3-Iodophenyl)methanesulfonyl chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.