L-Glutamic Acid-d5 is a deuterated form of the amino acid L-glutamic acid, commonly used as an analytical standard in research. Its isotopic labeling enables precise quantification in mass spectrometry and nuclear magnetic resonance studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
L-Glutamic Acid-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
L-Glutamine-d5
stable isotope labeled research standard
Aldoview precursor
research compound
Acetamide, N-[2-(5-methoxy-1-nitroso-1H-indol-3-yl)ethyl]-
Nitrosamine reference standard
Integrin Binding Peptide
integrin binding research reagent
N-Nitrosocarbazole
Nitrosamine impurity reference standard
Monosodium DL-glutamate
flavor enhancer
L-glutamic acid
nutritional supplement and flavor enhancer
Sodium glutamate monohydrate
flavor enhancer
(2S)-2-amino-2,3,3,4,4-pentadeuteriopentanedioic acid
WHUUTDBJXJRKMK-NKXUJHECSA-N
[2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])C(=O)O)N
L-Glutamic Acid-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.