Methyl 3-oxo-2-phenylbutanoate is a chemical compound used as a pharmaceutical intermediate. It features an aromatic ring and ester functional groups, with a molecular weight of 192.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 16648-44-5
Ethyl acetylphenylacetate
pharmaceutical intermediate
4-Bromo-1-naphthoic acid
Pharmaceutical intermediate
O-Benzyl-L-tyrosine
Pharmaceutical intermediate for peptide synthesis
Benzyl L-prolinate HCl
Pharmaceutical intermediate for proline derivatives
H-Ile-Obzl Tos
protected amino acid derivative
methyl 3-oxo-2-phenylbutanoate
CYSACHQWYQYLIG-UHFFFAOYSA-N
CC(=O)C(C1=CC=CC=C1)C(=O)OC