O-Benzyl-L-tyrosine is a protected derivative of the amino acid L-tyrosine, featuring a benzyl group attached to the phenolic oxygen. It is primarily used as a building block in solid-phase peptide synthesis, where the benzyl group serves as a temporary protecting group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 16652-64-5
Benzyl O-benzyl-L-tyrosinate--hydrogen chloride (1/1)
Research reagent for peptide synthesis
(S)-Benzyl 2-amino-3-(4-(benzyloxy)phenyl)propanoate
protected amino acid intermediate
Benzyl L-prolinate HCl
Pharmaceutical intermediate for proline derivatives
H-Ile-Obzl Tos
protected amino acid derivative
O-Benzyl-L-valine toluene-p-sulphonate
Pharmaceutical intermediate for peptide synthesis
4,6-dichloropyridine-3-carbonitrile
Pharmaceutical intermediate for drug synthesis
(2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoic acid
KAFHLONDOVSENM-HNNXBMFYSA-N
C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)O)N