This compound is a protected amino acid derivative, specifically the benzyl ester of L-isoleucine, presented as a salt with p-toluenesulfonic acid. It is commonly used as a pharmaceutical intermediate in the synthesis of peptides and other complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 16652-75-8
O-Benzyl-L-valine toluene-p-sulphonate
Pharmaceutical intermediate for peptide synthesis
L-Valine benzyl ester hydrochloride
Pharmaceutical intermediate
(R)-dimethyl 2-benzamidopentanedioate
protected amino acid derivative
4,6-dichloropyridine-3-carbonitrile
Pharmaceutical intermediate for drug synthesis
7-Desmethyl-3-hydroxyagomelatine
Pharmaceutical intermediate for agomelatine synthesis
5-Chloro-2-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzamide
pharmaceutical intermediate
O-((Guanin-9-yl)methyl) acyclovir
Pharmaceutical intermediate
benzyl (2S,3S)-2-amino-3-methylpentanoate;4-methylbenzenesulfonic acid
XAWVXTVKSVYPNE-JGAZGGJJSA-N
CC[C@H](C)[C@@H](C(=O)OCC1=CC=CC=C1)N.CC1=CC=C(C=C1)S(=O)(=O)O