This compound is a protected derivative of D-glutamic acid, featuring both benzoyl and methyl ester protecting groups. It is primarily used as a pharmaceutical intermediate in the synthesis of peptides and other complex organic molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(R)-dimethyl 2-benzamidopentanedioate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
H-Ile-Obzl Tos
protected amino acid derivative
2-Hydroxy-5-iodopyridine
Pharmaceutical intermediate
5-Bromo-2-methoxypyridine
pharmaceutical intermediate
N-Nitrosonadolol
Nitrosamine impurity standard
2(1H)-Quinazolinone, 4-amino-6,7-dimethoxy-, monohydrochloride
Pharmaceutical intermediate for quinazolinone synthesis
dimethyl (2R)-2-benzamidopentanedioate
JOTSRQZZNLVBKG-LLVKDONJSA-N
COC(=O)CC[C@H](C(=O)OC)NC(=O)C1=CC=CC=C1
(R)-dimethyl 2-benzamidopentanedioate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.