This compound is a protected amino acid intermediate, specifically the benzyl ester of O4-benzyl-L-tyrosine. It features a core tyrosine structure with both amino and carboxyl groups protected, making it suitable for use in peptide synthesis and pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(S)-Benzyl 2-amino-3-(4-(benzyloxy)phenyl)propanoate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Benzyl O-benzyl-L-tyrosinate--hydrogen chloride (1/1)
Research reagent for peptide synthesis
H-Phe-OBzl.TosOH
protected phenylalanine derivative for peptide synthesis
L-Phenylalanine benzyl ester hydrochloride
Peptide synthesis intermediate
O-Benzyl-L-tyrosine
Pharmaceutical intermediate for peptide synthesis
Ethyl N-(tert-butoxycarbonyl)-L-tyrosinate
protected amino acid intermediate
N-(Diphenylmethylene)glycine tert-butyl ester
protected amino acid intermediate
Dicyclohexylamine (S)-2-(((benzyloxy)carbonyl)amino)-4-((tert-butoxycarbonyl)amino)butanoate
protected amino acid intermediate
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
benzyl (2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoate
UCRXQUVKDMVBBM-QFIPXVFZSA-N
C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)OCC3=CC=CC=C3)N
(S)-Benzyl 2-amino-3-(4-(benzyloxy)phenyl)propanoate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.