Ethyl acetylphenylacetate is a chemical compound used as a pharmaceutical intermediate in drug manufacturing. It features an aromatic ring and ester functional groups, contributing to its role in the synthesis of various active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 5413-05-8
Diethyl phenylmalonate
n.a
3-ethoxy-3-oxo-2-phenylpropanoic acid
Pharmaceutical intermediate
Methyl 3-oxo-2-phenylbutanoate
Pharmaceutical intermediate
5-Amino-4,6-dichloropyrimidine
pharmaceutical intermediate
Bis(2-bromoethyl) ether
pharmaceutical intermediate
(8S,13S,14S,17R)-13-Methyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,4,6,7,8,12,13,14,15,16,17-dodecahydrospiro(cyclopenta(a)phenanthrene-3,2'-(1,3)dioxolan)-17-ol
Pharmaceutical intermediate for steroid synthesis
1-(4-Pyridinyl)pyridinium chloride hydrochloride
pharmaceutical intermediate
ethyl 3-oxo-2-phenylbutanoate
PWRUKIPYVGHRFL-UHFFFAOYSA-N
CCOC(=O)C(C1=CC=CC=C1)C(=O)C