1,2,3,4,5-Pentadeuterio-6-methylbenzene is a deuterated analytical standard that serves as an isotopically labeled reference compound for quantitative analysis. Its structure features a methyl-substituted aromatic ring where five hydrogen atoms are replaced by deuterium, making it valuable for mass spectrometry and nuclear magnetic resonance spectroscopy calibration.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,2,3,4,5-pentadeuterio-6-methylbenzene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-HEPTANONE-1,1,1,3,3-D5
deuterated analytical standard
Trans-Cinnamic-d7 acid
deuterated analytical standard
Dimethyl succinate-d4
deuterated analytical standard
(2H10)Cyclohexanone
deuterated analytical standard
X-NeuNAc
Chromogenic substrate for neuraminidase assay
1-(1-bromoethyl)-3,5-bis(trifluoromethyl)benzene
Research reagent for organic synthesis
Hepps
buffer reagent
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-propyl-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite] (9CI)
RNA synthesis building block
1,2,3,4,5-pentadeuterio-6-methylbenzene(CAS 1603-99-2)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,2,3,4,5-pentadeuterio-6-methylbenzene
YXFVVABEGXRONW-VIQYUKPQSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C)[2H])[2H]
1,2,3,4,5-pentadeuterio-6-methylbenzene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.