Dimethyl succinate-d4 is a deuterated analytical standard, specifically the tetradeuterated form of dimethyl succinate where four hydrogen atoms are replaced with deuterium. It is primarily used as a reference material in analytical chemistry for quantification and method validation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dimethyl succinate-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
BIS(2-ETHOXYETHYL) PHTHALATE-3,4,5,6-D4
deuterated analytical standard
(2H10)Cyclohexanone
deuterated analytical standard
Di((2H3)methyl)ammonium chloride
deuterated analytical standard
Dibenzo[b,d]furan-d8
deuterated analytical standard
Fargesin
research compound
2,4-Diaminomesitylene
research compound
Tetra-n-butylammonium hexafluorophosphate
supporting electrolyte for electrochemistry
Tetrabutylammonium iodide
lipophilic salt preparation reagent
Dimethyl succinate-d4(CAS 30994-23-1)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
dimethyl 2,2,3,3-tetradeuteriobutanedioate
MUXOBHXGJLMRAB-KHORGVISSA-N
[2H]C([2H])(C(=O)OC)C([2H])([2H])C(=O)OC
Dimethyl succinate-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.