(2H10)Cyclohexanone is a fully deuterated analog of cyclohexanone, used as an analytical standard in research. Its isotopic labeling makes it valuable for mass spectrometry and nuclear magnetic resonance studies, particularly in structural chemistry investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2H10)Cyclohexanone 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-HEPTANONE-1,1,1,3,3-D5
deuterated analytical standard
Di((2H3)methyl)ammonium chloride
deuterated analytical standard
Pentanedioic-d6 acid
deuterated analytical standard
1,2,3,4,5-pentadeuterio-6-methylbenzene
deuterated analytical standard
Tris(di(2H3)methylamido)phosphorus
Deuterated research compound
4-Biphenylboronic acid
research compound
(3-phenylphenyl)boronic Acid
Boronic acid research compound
4-Iodophenylboronic acid
Boronic acid reagent for synthesis
2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexan-1-one
JHIVVAPYMSGYDF-YXALHFAPSA-N
[2H]C1(C(=O)C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H]
(2H10)Cyclohexanone 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.