(2H10)Cyclohexanone is a fully deuterated analog of cyclohexanone, used as an analytical standard in research. Its isotopic labeling makes it valuable for mass spectrometry and nuclear magnetic resonance studies, particularly in structural chemistry investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 51209-49-5
2-HEPTANONE-1,1,1,3,3-D5
deuterated analytical standard
Di((2H3)methyl)ammonium chloride
deuterated analytical standard
Pentanedioic-d6 acid
deuterated analytical standard
1,2,3,4,5-pentadeuterio-6-methylbenzene
deuterated analytical standard
Tris(di(2H3)methylamido)phosphorus
Deuterated research compound
4-Biphenylboronic acid
research compound
(3-phenylphenyl)boronic Acid
Boronic acid research compound
4-Iodophenylboronic acid
Boronic acid reagent for synthesis
2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexan-1-one
JHIVVAPYMSGYDF-YXALHFAPSA-N
[2H]C1(C(=O)C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H]