2-Heptanone-1,1,1,3,3-d5 is a deuterium-labeled isotopologue of 2-heptanone, specifically deuterated at the 1,1,1,3,3 positions. It is primarily used as an internal standard in analytical chemistry for quantification and method development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-HEPTANONE-1,1,1,3,3-D5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Nonanone-1,1,1,3,3-D5
Deuterated research reference standard
2-Hexanone-1,1,1,3,3-d5
Deuterated analytical reference standard
2-Pentanone-1,1,1,3,3-d5
Deuterated research reference standard
(2H10)Cyclohexanone
deuterated analytical standard
Tris(2-ethylhexyl) Phosphate-d51
deuterated analytical standard
Trans-Cinnamic-d7 acid
deuterated analytical standard
Dimethyl succinate-d4
deuterated analytical standard
4-Hydrazinobenzoic acid hydrochloride
Laboratory research reagent
1,1,1,3,3-pentadeuterioheptan-2-one
CATSNJVOTSVZJV-QKLSXCJMSA-N
[2H]C([2H])([2H])C(=O)C([2H])([2H])CCCC
2-HEPTANONE-1,1,1,3,3-D5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.