2-(Methyl-d3)-aniline is a deuterium-labeled research reagent. It is an aniline derivative with three deuterium atoms substituted on the methyl group, commonly used in analytical and pharmaceutical research for tracing or metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-(Methyl-d3)-aniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
PIPERAZINE-2,2,3,3,5,5,6,6-D8
Deuterated research reagent
(2H7)Aniline
Deuterated research reagent
4-Bromoanisole-2,3,5,6-d4
Deuterated research reagent
3-Picoline-d7
Deuterated research reagent
2-Hydroxyphenylthiourea
research compound
Perylene, perdeutero-
deuterated reference standard
23-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3,6,9,12,15,18,21-heptaoxatricosanoic acid
PEGylated Fmoc-protected amino acid reagent
3-Fluoropyridine-2-carboxylic acid
research compound
2-(trideuteriomethyl)aniline
RNVCVTLRINQCPJ-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=CC=C1N
2-(Methyl-d3)-aniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.