This compound is a PEGylated Fmoc-protected amino acid reagent used in laboratory research. Its structure features a long polyethylene glycol chain linked to a fluorenylmethoxycarbonyl (Fmoc) protected amine and a terminal carboxylic acid, making it highly flexible and polar.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-{2-[2-({[(9H-FLUOREN-9-YL)METHOXY]CARBONYL}AMINO)ETHOXY]ETHOXY}ACETIC ACID
Fmoc-protected PEG linker for peptide synthesis
1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13-tetraoxa-4-azapentadecan-15-oic acid
Pharmaceutical intermediate for PEGylated compounds
2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)ethoxy)acetic acid
Research compound for conjugation
Fmoc-AEEA-AEEA
peptide synthesis intermediate
3-Fluoropyridine-2-carboxylic acid
research compound
3-Fluoropyridine-2-carboxamide
research compound
(1R)-1-(4-CHLOROPHENYL)ETHANE-1,2-DIOL
research compound or reference standard
Hexafluoroacetylacetone
research reagent for coordination chemistry
2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid
KHCPJBPPFACKPC-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCOCCOCCOCCOCC(=O)O
—
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.