This compound is a PEGylated pharmaceutical intermediate featuring a fluorenylmethoxycarbonyl (Fmoc) protecting group and a terminal carboxylic acid. It is primarily used in the synthesis of PEGylated compounds for research and pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
23-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3,6,9,12,15,18,21-heptaoxatricosanoic acid
PEGylated Fmoc-protected amino acid reagent
2-{2-[2-({[(9H-FLUOREN-9-YL)METHOXY]CARBONYL}AMINO)ETHOXY]ETHOXY}ACETIC ACID
Fmoc-protected PEG linker for peptide synthesis
2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)ethoxy)acetic acid
Research compound for conjugation
Fmoc-AEEA-AEEA
peptide synthesis intermediate
5-Bromo-2-(trifluoromethoxy)benzyl chloride
Pharmaceutical intermediate
5-Acetyl-6-hydroxypicolinaldehyde
pharmaceutical intermediate
2-[(3R,5R)-3,5-Bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]cyclohexylidene]ethanol
Pharmaceutical intermediate
(2-((3R,5R)-3,5-Bis((tert-butyldimethylsilyl)oxy)cyclohexylidene)ethyl)diphenylphosphine oxide
phosphine oxide intermediate for synthesis
2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]acetic acid
XNOJSAOJCBOZTA-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCC(=O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.