3-Picoline-d7 is a deuterated form of 3-picoline, where all hydrogen atoms on the pyridine ring and the methyl group are replaced with deuterium. It is primarily used as a research reagent in laboratories, particularly in NMR spectroscopy and mass spectrometry as an internal standard or tracer in analytical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-Picoline-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Isobutyric-d7 acid
Deuterated research reagent
1-BROMO-2-(METHYL-D3)BENZENE
Deuterated research reagent
4-(2H3)methoxybenzoic acid
Deuterated research reagent
P-TOLUIDINE-D9
Deuterated research reagent
L-Valinol
chiral amino alcohol derivative
Nicotinoyl chloride hydrochloride
Chemical intermediate for synthesis
3-amino-2-methoxypyridine
research compound
Tris(hydroxymethyl-d3)amino-d2-methane
deuterated research reagent
2,3,4,6-tetradeuterio-5-(trideuteriomethyl)pyridine
ITQTTZVARXURQS-AAYPNNLASA-N
[2H]C1=C(C(=C(N=C1[2H])[2H])C([2H])([2H])[2H])[2H]
3-Picoline-d7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.