1-Bromo-2-(methyl-d3)benzene is a deuterated research reagent used in laboratory settings. Its structure features a bromine atom and a fully deuterated methyl group attached to an aromatic ring, making it valuable for isotopic labeling studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 25319-52-2
4-(2H3)methoxybenzoic acid
Deuterated research reagent
4-Bromoanisole-2,3,5,6-d4
Deuterated research reagent
P-TOLUIDINE-D9
Deuterated research reagent
2-Ethylhexanoic-d15 acid
Deuterated research reagent
1,2-bis(trideuteriomethyl)benzene
isotopically labeled research compound
1,2-Octanedione, 1-(4-(phenylthio)phenyl)-, 2-(O-benzoyloxime)
research compound
Diethyl cyanomethylphosphonate
phosphonate reagent for synthesis
Hexanedioic-2,2,3,3,4,4,5,5-d8 acid-1,6-d2
isotopic labeled analytical reference standard
1-bromo-2-(trideuteriomethyl)benzene
QSSXJPIWXQTSIX-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=CC=C1Br