This compound is a deuterated form of piperazine, specifically labeled with eight deuterium atoms at the 2,2,3,3,5,5,6,6 positions. It is primarily used as a research reagent in laboratory settings, particularly for studies involving isotopic labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 134628-42-5
Piperazine-2,2,3,3,5,5,6,6-d8 dihydrochloride
deuterated research standard compound
(2H7)Aniline
Deuterated research reagent
2-(Methyl-d3)-aniline
Deuterated research reagent
4-Bromoanisole-2,3,5,6-d4
Deuterated research reagent
3-Picoline-d7
Deuterated research reagent
2,3-Dimethylphenylmagnesium bromide
Grignard reagent for organic synthesis
Nonanoic acid-d3
deuterated fatty acid reference standard
Rhodium(III) nitrate dihydrate
research compound
2,2,3,3,5,5,6,6-octadeuteriopiperazine
GLUUGHFHXGJENI-SVYQBANQSA-N
[2H]C1(C(NC(C(N1)([2H])[2H])([2H])[2H])([2H])[2H])[2H]