This compound is a protected macrocyclic chelating agent featuring a 1,4,7,10-tetraazacyclododecane core with tert-butyl ester protecting groups and a single carboxylic acid moiety. It is primarily used in research for the synthesis of metal chelating constructs, where the protecting groups allow controlled deprotection and functionalization.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
NOTA-bis(tBu)ester
research compound
Xenon tetrafluoride
noble gas binary compound reagent
Di-tert-butylchlorophosphine
organophosphorus reagent for synthesis
Tri-tert-butylphosphine
phosphine ligand for palladium catalysis
Atorvastatin IMpurity F
Reference standard for impurity analysis
DOTA-GA(tBu)4
chelating agent precursor
DOTA
chelating agent for metal ions
10-(2-hydroxypropyl)-1,4,7,10-tetraazacyclododecane-1,4,7-triacetic acid
Chelating agent intermediate for MRI contrast agents
2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid
RVUXZXMKYMSWOM-UHFFFAOYSA-N
CC(C)(C)OC(=O)CN1CCN(CCN(CCN(CC1)CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)CC(=O)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.