DOTA is a chelating agent designed to bind metal ions with high affinity, commonly used in laboratory and industrial settings. It is a synthetic compound featuring multiple carboxylic acid and amine groups that coordinate metal ions for various research and manufacturing applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
DOTA 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-(Pyrrolidin-1-Yl)Acetic Acid Hydrochloride
pharmaceutical intermediate
Dotam-mono acid
chelating ligand for metal ions
Bursopoietin
cell differentiation agent
Gestoden
progestogen hormonal contraceptive
Proxyphylline
active pharmaceutical ingredient
Bisacodyl
pharmaceutical active ingredient
Gadoteric acid
MRI contrast agent
Dotarem
MRI contrast agent
DOTA(CAS 60239-18-1)의 국제 HS 코드는 2933.99입니다.
2933.99
2933 99 80
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid
WDLRUFUQRNWCPK-UHFFFAOYSA-N
C1CN(CCN(CCN(CCN1CC(=O)O)CC(=O)O)CC(=O)O)CC(=O)O
DOTA 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.