Dotam-mono acid is a research reagent and chelating ligand derived from a tetraazacyclododecane macrocycle. Its structure features three amide groups and one carboxylic acid group, enabling it to bind metal ions for coordination chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 913528-04-8
DOTA
chelating agent for metal ions
(p-SCN-Bn)-dota
chelating ligand for metal ions
P-SCN-Bn-TCMC
chelating ligand for metal ions
1-(1-benzothiophen-4-yl)piperazine hydrochloride
research compound
Benzoic acid, 4-chloro-3-methyl-, methyl ester
Chemical research reagent
(2S)-3,3-Dimethyl-2-[[(1-methyl-1H-imidazol-2-yl)methyl]amino]-N-[(1R)-1,2,2-trimethylpropyl]butanamide
Research reagent for desymmetrization catalysis
(2-bromo-6-fluorophenyl)boronic acid
Research reagent for synthesis
Dotarem
MRI contrast agent
2-[4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid
DFPHZEYJGWLQJE-UHFFFAOYSA-N
C1CN(CCN(CCN(CCN1CC(=O)N)CC(=O)N)CC(=O)O)CC(=O)N