NOTA-bis(tBu)ester is a research reagent derived from the NOTA (1,4,7-triazacyclononane-1,4,7-triacetic acid) chelator platform. It features two tert-butyl ester protecting groups and is primarily used in laboratory settings for the synthesis of bifunctional chelating agents or radiolabeling precursors.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
NOTA-bis(tBu)ester 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Tri-tert-butyl 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetate
protected macrocyclic chelating agent
12(S)-HEPE
assay reference standard
(3R)-pyrrolidin-3-amine
chiral amine research building block
Tert-butyl (3S,4S)-4-amino-3-hydroxypiperidine-1-carboxylate
research compound
2,5-Diiodopyridine
Research reagent
(R)-NODAGA-tris(t-Bu ester)
chelating agent intermediate for bioconjugation
(S)-4-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5-oxopentanoic acid
research reagent
1,4,7-Triazacyclononane
crown amine ligand for coordination chemistry
2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid
UACSRZWSADEYPK-UHFFFAOYSA-N
CC(C)(C)OC(=O)CN1CCN(CCN(CC1)CC(=O)OC(C)(C)C)CC(=O)O
NOTA-bis(tBu)ester 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.